Abstract
This invention relates to diacrylate copolymers of formula CH2=CR'COO-(CH2)n-R-(CH2)n-OOCCR'=CH2, wherein R is selected from the group consisting of i) an oligomer comprising copolymerized units of vinylidene fluoride and perfluoro(methyl vinyl ether), ii) an oligomer comprising copolymerized units of vinylidene fluoride and hexafluoropropylene, iii) an oligomer comprising copolymerized units of tetrafluoroethylene and perfluoro(methyl vinyl ether), and iv) an oligomer comprising copolymerized units of tetrafluoroethylene and a hydrocarbon olefin, R' is H or -CH3, n is 1-4, and wherein said oligomer has a number average molecular weight of 1000 to 25,000 daltons.